C24H22F7N5O2S — CID 58464765
2-(2,6-difluorophenyl)-N-[5-[4,4-difluoro-5-(3,3,3-trifluoro-2-oxopropyl)azepan-1-yl]-1-methylpyrazol-4-yl]-5-methyl-1,3-thiazole-4-carboxamide (PubChem CID 58464765) has the molecular formula C24H22F7N5O2S and a molecular weight of 577.53 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-N-[5-[4,4-difluoro-5-(3,3,3-trifluoro-2-oxopropyl)azepan-1-yl]-1-methylpyrazol-4-yl]-5-methyl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(2,6-difluorophenyl)-N-[5-[4,4-difluoro-5-(3,3,3-trifluoro-2-oxopropyl)azepan-1-yl]-1-methylpyrazol-4-yl]-5-methyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 58464765 |
| Molecular Formula | C24H22F7N5O2S |
| Molecular Weight | 577.53 g/mol |
| Exact Mass | 577.14 |
| IUPAC Name | 2-(2,6-difluorophenyl)-N-[5-[4,4-difluoro-5-(3,3,3-trifluoro-2-oxopropyl)azepan-1-yl]-1-methylpyrazol-4-yl]-5-methyl-1,3-thiazole-4-carboxamide |
| SMILES | Cc1sc(-c2c(F)cccc2F)nc1C(=O)Nc1cnn(C)c1N1CCC(CC(=O)C(F)(F)F)C(F)(F)CC1 |
| InChI | InChI=1S/C24H22F7N5O2S/c1-12-19(34-21(39-12)18-14(25)4-3-5-15(18)26)20(38)33-16-11-32-35(2)22(16)36-8-6-13(23(27,28)7-9-36)10-17(37)24(29,30)31/h3-5,11,13H,6-10H2,1-2H3,(H,33,38) |
| InChIKey | OCGKAZCRBMMLIP-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.53 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |