C13H15F5N4O3 — CID 58465057
3-[5,5-difluoro-1-(1-methyl-4-nitropyrazol-5-yl)azepan-4-yl]-1,1,1-trifluoropropan-2-one (PubChem CID 58465057) has the molecular formula C13H15F5N4O3 and a molecular weight of 370.28 g/mol. Its IUPAC name is 3-[5,5-difluoro-1-(1-methyl-4-nitropyrazol-5-yl)azepan-4-yl]-1,1,1-trifluoropropan-2-one.
| Compound Name | 3-[5,5-difluoro-1-(1-methyl-4-nitropyrazol-5-yl)azepan-4-yl]-1,1,1-trifluoropropan-2-one |
|---|---|
| PubChem CID | 58465057 |
| Molecular Formula | C13H15F5N4O3 |
| Molecular Weight | 370.28 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 3-[5,5-difluoro-1-(1-methyl-4-nitropyrazol-5-yl)azepan-4-yl]-1,1,1-trifluoropropan-2-one |
| SMILES | Cn1ncc([N+](=O)[O-])c1N1CCC(CC(=O)C(F)(F)F)C(F)(F)CC1 |
| InChI | InChI=1S/C13H15F5N4O3/c1-20-11(9(7-19-20)22(24)25)21-4-2-8(12(14,15)3-5-21)6-10(23)13(16,17)18/h7-8H,2-6H2,1H3 |
| InChIKey | BAORQPGCNMXQME-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 81.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.28 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|