C28H27NO5 — CID 58465340
5,8-diethoxy-3-(4-methoxyphenyl)-6-phenacyl-1H-quinolin-4-one (PubChem CID 58465340) has the molecular formula C28H27NO5 and a molecular weight of 457.53 g/mol. Its IUPAC name is 5,8-diethoxy-3-(4-methoxyphenyl)-6-phenacyl-1H-quinolin-4-one.
| Compound Name | 5,8-diethoxy-3-(4-methoxyphenyl)-6-phenacyl-1H-quinolin-4-one |
|---|---|
| PubChem CID | 58465340 |
| Molecular Formula | C28H27NO5 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | 5,8-diethoxy-3-(4-methoxyphenyl)-6-phenacyl-1H-quinolin-4-one |
| SMILES | CCOc1cc(CC(=O)c2ccccc2)c(OCC)c2c(=O)c(-c3ccc(OC)cc3)c[nH]c12 |
| InChI | InChI=1S/C28H27NO5/c1-4-33-24-16-20(15-23(30)19-9-7-6-8-10-19)28(34-5-2)25-26(24)29-17-22(27(25)31)18-11-13-21(32-3)14-12-18/h6-14,16-17H,4-5,15H2,1-3H3,(H,29,31) |
| InChIKey | UVVQYSXYBMZZRH-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 77.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |