About 4-tert-butyl-1-(2,3,3-trimethylbutan-2-yl)piperidine
4-tert-butyl-1-(2,3,3-trimethylbutan-2-yl)piperidine (PubChem CID 58465365) has the molecular formula C16H33N
and a molecular weight of 239.45 g/mol. Its IUPAC name is 4-tert-butyl-1-(2,3,3-trimethylbutan-2-yl)piperidine.
Molecular Properties
| Compound Name | 4-tert-butyl-1-(2,3,3-trimethylbutan-2-yl)piperidine |
| PubChem CID | 58465365 |
| Molecular Formula | C16H33N |
| Molecular Weight | 239.45 g/mol |
| Exact Mass | 239.26 |
| IUPAC Name | 4-tert-butyl-1-(2,3,3-trimethylbutan-2-yl)piperidine |
| SMILES | CC(C)(C)C1CCN(C(C)(C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C16H33N/c1-14(2,3)13-9-11-17(12-10-13)16(7,8)15(4,5)6/h13H,9-12H2,1-8H3 |
| InChIKey | MVQVUCAKYVXMJC-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.45 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-tert-butyl-1-(2,3,3-trimethylbutan-2-yl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-1-(2,3,3-trimethylbutan-2-yl)piperidine?
The IUPAC name of 4-tert-butyl-1-(2,3,3-trimethylbutan-2-yl)piperidine (CID 58465365) is 4-tert-butyl-1-(2,3,3-trimethylbutan-2-yl)piperidine.
What is the SMILES notation for 4-tert-butyl-1-(2,3,3-trimethylbutan-2-yl)piperidine?
The canonical SMILES for 4-tert-butyl-1-(2,3,3-trimethylbutan-2-yl)piperidine is CC(C)(C)C1CCN(C(C)(C)C(C)(C)C)CC1.
What is the InChIKey of 4-tert-butyl-1-(2,3,3-trimethylbutan-2-yl)piperidine?
The InChIKey is MVQVUCAKYVXMJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H33N/c1-14(2,3)13-9-11-17(12-10-13)16(7,8)15(4,5)6/h13H,9-12H2,1-8H3.
What are the key properties of 4-tert-butyl-1-(2,3,3-trimethylbutan-2-yl)piperidine?
4-tert-butyl-1-(2,3,3-trimethylbutan-2-yl)piperidine has a molecular weight of 239.45 g/mol, XLogP of 4.57, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-1-(2,3,3-trimethylbutan-2-yl)piperidine is sourced from PubChem (CID 58465365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).