C15H21N3O3 — CID 58465664
2-(cyclohexanecarbonyl)-N-hydroxy-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-7-carboxamide (PubChem CID 58465664) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is 2-(cyclohexanecarbonyl)-N-hydroxy-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-7-carboxamide.
| Compound Name | 2-(cyclohexanecarbonyl)-N-hydroxy-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 58465664 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 2-(cyclohexanecarbonyl)-N-hydroxy-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-7-carboxamide |
| SMILES | O=C(NO)c1cc2n(c1)CCN(C(=O)C1CCCCC1)C2 |
| InChI | InChI=1S/C15H21N3O3/c19-14(16-21)12-8-13-10-18(7-6-17(13)9-12)15(20)11-4-2-1-3-5-11/h8-9,11,21H,1-7,10H2,(H,16,19) |
| InChIKey | IRYNPILZVVOIKV-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 74.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|