About ethyl 4-acetylcyclopenta-1,4-diene-1-carboxylate
ethyl 4-acetylcyclopenta-1,4-diene-1-carboxylate (PubChem CID 58465807) has the molecular formula C10H12O3
and a molecular weight of 180.20 g/mol. Its IUPAC name is ethyl 4-acetylcyclopenta-1,4-diene-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-acetylcyclopenta-1,4-diene-1-carboxylate |
| PubChem CID | 58465807 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | ethyl 4-acetylcyclopenta-1,4-diene-1-carboxylate |
| SMILES | CCOC(=O)C1=CCC(C(C)=O)=C1 |
| InChI | InChI=1S/C10H12O3/c1-3-13-10(12)9-5-4-8(6-9)7(2)11/h5-6H,3-4H2,1-2H3 |
| InChIKey | UIINLCXOXQNBGO-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 4-acetylcyclopenta-1,4-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-acetylcyclopenta-1,4-diene-1-carboxylate?
The IUPAC name of ethyl 4-acetylcyclopenta-1,4-diene-1-carboxylate (CID 58465807) is ethyl 4-acetylcyclopenta-1,4-diene-1-carboxylate.
What is the SMILES notation for ethyl 4-acetylcyclopenta-1,4-diene-1-carboxylate?
The canonical SMILES for ethyl 4-acetylcyclopenta-1,4-diene-1-carboxylate is CCOC(=O)C1=CCC(C(C)=O)=C1.
What is the InChIKey of ethyl 4-acetylcyclopenta-1,4-diene-1-carboxylate?
The InChIKey is UIINLCXOXQNBGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3/c1-3-13-10(12)9-5-4-8(6-9)7(2)11/h5-6H,3-4H2,1-2H3.
What are the key properties of ethyl 4-acetylcyclopenta-1,4-diene-1-carboxylate?
ethyl 4-acetylcyclopenta-1,4-diene-1-carboxylate has a molecular weight of 180.20 g/mol, XLogP of 1.39, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-acetylcyclopenta-1,4-diene-1-carboxylate is sourced from PubChem (CID 58465807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).