C16H25N3O3 — CID 58465839
2-(2,2-dimethylpropanoyl)-N-hydroxy-4,4-dimethyl-3,5-dihydro-1H-pyrrolo[1,2-a][1,4]diazepine-8-carboxamide (PubChem CID 58465839) has the molecular formula C16H25N3O3 and a molecular weight of 307.39 g/mol. Its IUPAC name is 2-(2,2-dimethylpropanoyl)-N-hydroxy-4,4-dimethyl-3,5-dihydro-1H-pyrrolo[1,2-a][1,4]diazepine-8-carboxamide.
| Compound Name | 2-(2,2-dimethylpropanoyl)-N-hydroxy-4,4-dimethyl-3,5-dihydro-1H-pyrrolo[1,2-a][1,4]diazepine-8-carboxamide |
|---|---|
| PubChem CID | 58465839 |
| Molecular Formula | C16H25N3O3 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | 2-(2,2-dimethylpropanoyl)-N-hydroxy-4,4-dimethyl-3,5-dihydro-1H-pyrrolo[1,2-a][1,4]diazepine-8-carboxamide |
| SMILES | CC1(C)CN(C(=O)C(C)(C)C)Cc2cc(C(=O)NO)cn2C1 |
| InChI | InChI=1S/C16H25N3O3/c1-15(2,3)14(21)19-8-12-6-11(13(20)17-22)7-18(12)9-16(4,5)10-19/h6-7,22H,8-10H2,1-5H3,(H,17,20) |
| InChIKey | GATGTBQAKOBBIJ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 74.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|