About 3-(4-methylphenyl)-2H-1,4-benzoxazine
3-(4-methylphenyl)-2H-1,4-benzoxazine (PubChem CID 58466109) has the molecular formula C15H13NO
and a molecular weight of 223.28 g/mol. Its IUPAC name is 3-(4-methylphenyl)-2H-1,4-benzoxazine.
Molecular Properties
| Compound Name | 3-(4-methylphenyl)-2H-1,4-benzoxazine |
| PubChem CID | 58466109 |
| Molecular Formula | C15H13NO |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 3-(4-methylphenyl)-2H-1,4-benzoxazine |
| SMILES | Cc1ccc(C2=Nc3ccccc3OC2)cc1 |
| InChI | InChI=1S/C15H13NO/c1-11-6-8-12(9-7-11)14-10-17-15-5-3-2-4-13(15)16-14/h2-9H,10H2,1H3 |
| InChIKey | JLCKPIGODWGYAB-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(4-methylphenyl)-2H-1,4-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methylphenyl)-2H-1,4-benzoxazine?
The IUPAC name of 3-(4-methylphenyl)-2H-1,4-benzoxazine (CID 58466109) is 3-(4-methylphenyl)-2H-1,4-benzoxazine.
What is the SMILES notation for 3-(4-methylphenyl)-2H-1,4-benzoxazine?
The canonical SMILES for 3-(4-methylphenyl)-2H-1,4-benzoxazine is Cc1ccc(C2=Nc3ccccc3OC2)cc1.
What is the InChIKey of 3-(4-methylphenyl)-2H-1,4-benzoxazine?
The InChIKey is JLCKPIGODWGYAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO/c1-11-6-8-12(9-7-11)14-10-17-15-5-3-2-4-13(15)16-14/h2-9H,10H2,1H3.
What are the key properties of 3-(4-methylphenyl)-2H-1,4-benzoxazine?
3-(4-methylphenyl)-2H-1,4-benzoxazine has a molecular weight of 223.28 g/mol, XLogP of 3.51, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methylphenyl)-2H-1,4-benzoxazine is sourced from PubChem (CID 58466109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).