C15H9Br2FN2O2 — CID 58466118
(4S)-2',7'-dibromo-4'-fluorospiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine (PubChem CID 58466118) has the molecular formula C15H9Br2FN2O2 and a molecular weight of 428.06 g/mol. Its IUPAC name is (4S)-2',7'-dibromo-4'-fluorospiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine.
| Compound Name | (4S)-2',7'-dibromo-4'-fluorospiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine |
|---|---|
| PubChem CID | 58466118 |
| Molecular Formula | C15H9Br2FN2O2 |
| Molecular Weight | 428.06 g/mol |
| Exact Mass | 425.90 |
| IUPAC Name | (4S)-2',7'-dibromo-4'-fluorospiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine |
| SMILES | NC1=N[C@@]2(CO1)c1cc(Br)ccc1Oc1c(F)cc(Br)cc12 |
| InChI | InChI=1S/C15H9Br2FN2O2/c16-7-1-2-12-9(3-7)15(6-21-14(19)20-15)10-4-8(17)5-11(18)13(10)22-12/h1-5H,6H2,(H2,19,20)/t15-/m0/s1 |
| InChIKey | PYWROVYLUJRCDJ-HNNXBMFYSA-N |
| XLogP | 4.04 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.06 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |