About 2-amino-7'-pyrimidin-5-ylspiro[5H-1,3-oxazole-4,9'-xanthene]-2'-ol
2-amino-7'-pyrimidin-5-ylspiro[5H-1,3-oxazole-4,9'-xanthene]-2'-ol (PubChem CID 58466141) has the molecular formula C19H14N4O3
and a molecular weight of 346.35 g/mol. Its IUPAC name is 2-amino-7'-pyrimidin-5-ylspiro[5H-1,3-oxazole-4,9'-xanthene]-2'-ol.
Molecular Properties
| Compound Name | 2-amino-7'-pyrimidin-5-ylspiro[5H-1,3-oxazole-4,9'-xanthene]-2'-ol |
| PubChem CID | 58466141 |
| Molecular Formula | C19H14N4O3 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 2-amino-7'-pyrimidin-5-ylspiro[5H-1,3-oxazole-4,9'-xanthene]-2'-ol |
| SMILES | NC1=NC2(CO1)c1cc(O)ccc1Oc1ccc(-c3cncnc3)cc12 |
| InChI | InChI=1S/C19H14N4O3/c20-18-23-19(9-25-18)14-5-11(12-7-21-10-22-8-12)1-3-16(14)26-17-4-2-13(24)6-15(17)19/h1-8,10,24H,9H2,(H2,20,23) |
| InChIKey | JMXUGEPAXJWRDS-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 102.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-amino-7'-pyrimidin-5-ylspiro[5H-1,3-oxazole-4,9'-xanthene]-2'-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-7'-pyrimidin-5-ylspiro[5H-1,3-oxazole-4,9'-xanthene]-2'-ol?
The IUPAC name of 2-amino-7'-pyrimidin-5-ylspiro[5H-1,3-oxazole-4,9'-xanthene]-2'-ol (CID 58466141) is 2-amino-7'-pyrimidin-5-ylspiro[5H-1,3-oxazole-4,9'-xanthene]-2'-ol.
What is the SMILES notation for 2-amino-7'-pyrimidin-5-ylspiro[5H-1,3-oxazole-4,9'-xanthene]-2'-ol?
The canonical SMILES for 2-amino-7'-pyrimidin-5-ylspiro[5H-1,3-oxazole-4,9'-xanthene]-2'-ol is NC1=NC2(CO1)c1cc(O)ccc1Oc1ccc(-c3cncnc3)cc12.
What is the InChIKey of 2-amino-7'-pyrimidin-5-ylspiro[5H-1,3-oxazole-4,9'-xanthene]-2'-ol?
The InChIKey is JMXUGEPAXJWRDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14N4O3/c20-18-23-19(9-25-18)14-5-11(12-7-21-10-22-8-12)1-3-16(14)26-17-4-2-13(24)6-15(17)19/h1-8,10,24H,9H2,(H2,20,23).
What are the key properties of 2-amino-7'-pyrimidin-5-ylspiro[5H-1,3-oxazole-4,9'-xanthene]-2'-ol?
2-amino-7'-pyrimidin-5-ylspiro[5H-1,3-oxazole-4,9'-xanthene]-2'-ol has a molecular weight of 346.35 g/mol, XLogP of 2.54, 1 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-7'-pyrimidin-5-ylspiro[5H-1,3-oxazole-4,9'-xanthene]-2'-ol is sourced from PubChem (CID 58466141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).