C22H20Cl3FN2O4 — CID 58468246
ethyl 3-[[2-fluoro-5-[5-methyl-5-(3,4,5-trichlorophenyl)-4H-1,2-oxazol-3-yl]phenyl]methylamino]-3-oxopropanoate (PubChem CID 58468246) has the molecular formula C22H20Cl3FN2O4 and a molecular weight of 501.77 g/mol. Its IUPAC name is ethyl 3-[[2-fluoro-5-[5-methyl-5-(3,4,5-trichlorophenyl)-4H-1,2-oxazol-3-yl]phenyl]methylamino]-3-oxopropanoate.
| Compound Name | ethyl 3-[[2-fluoro-5-[5-methyl-5-(3,4,5-trichlorophenyl)-4H-1,2-oxazol-3-yl]phenyl]methylamino]-3-oxopropanoate |
|---|---|
| PubChem CID | 58468246 |
| Molecular Formula | C22H20Cl3FN2O4 |
| Molecular Weight | 501.77 g/mol |
| Exact Mass | 500.05 |
| IUPAC Name | ethyl 3-[[2-fluoro-5-[5-methyl-5-(3,4,5-trichlorophenyl)-4H-1,2-oxazol-3-yl]phenyl]methylamino]-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)NCc1cc(C2=NOC(C)(c3cc(Cl)c(Cl)c(Cl)c3)C2)ccc1F |
| InChI | InChI=1S/C22H20Cl3FN2O4/c1-3-31-20(30)9-19(29)27-11-13-6-12(4-5-17(13)26)18-10-22(2,32-28-18)14-7-15(23)21(25)16(24)8-14/h4-8H,3,9-11H2,1-2H3,(H,27,29) |
| InChIKey | MYELTFAVWSPWKF-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.77 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|