C22H21Cl3FN3O3 — CID 58468252
N-ethyl-N'-[[2-fluoro-5-[5-methyl-5-(3,4,5-trichlorophenyl)-4H-1,2-oxazol-3-yl]phenyl]methyl]propanediamide (PubChem CID 58468252) has the molecular formula C22H21Cl3FN3O3 and a molecular weight of 500.79 g/mol. Its IUPAC name is N-ethyl-N'-[[2-fluoro-5-[5-methyl-5-(3,4,5-trichlorophenyl)-4H-1,2-oxazol-3-yl]phenyl]methyl]propanediamide.
| Compound Name | N-ethyl-N'-[[2-fluoro-5-[5-methyl-5-(3,4,5-trichlorophenyl)-4H-1,2-oxazol-3-yl]phenyl]methyl]propanediamide |
|---|---|
| PubChem CID | 58468252 |
| Molecular Formula | C22H21Cl3FN3O3 |
| Molecular Weight | 500.79 g/mol |
| Exact Mass | 499.06 |
| IUPAC Name | N-ethyl-N'-[[2-fluoro-5-[5-methyl-5-(3,4,5-trichlorophenyl)-4H-1,2-oxazol-3-yl]phenyl]methyl]propanediamide |
| SMILES | CCNC(=O)CC(=O)NCc1cc(C2=NOC(C)(c3cc(Cl)c(Cl)c(Cl)c3)C2)ccc1F |
| InChI | InChI=1S/C22H21Cl3FN3O3/c1-3-27-19(30)9-20(31)28-11-13-6-12(4-5-17(13)26)18-10-22(2,32-29-18)14-7-15(23)21(25)16(24)8-14/h4-8H,3,9-11H2,1-2H3,(H,27,30)(H,28,31) |
| InChIKey | ZOVWJWILUFTXQU-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.79 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|