About 1-methyl-3-[(3S)-2,2,4-trimethylpentan-3-yl]urea
1-methyl-3-[(3S)-2,2,4-trimethylpentan-3-yl]urea (PubChem CID 58468761) has the molecular formula C10H22N2O
and a molecular weight of 186.30 g/mol. Its IUPAC name is 1-methyl-3-[(3S)-2,2,4-trimethylpentan-3-yl]urea.
Molecular Properties
| Compound Name | 1-methyl-3-[(3S)-2,2,4-trimethylpentan-3-yl]urea |
| PubChem CID | 58468761 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | 1-methyl-3-[(3S)-2,2,4-trimethylpentan-3-yl]urea |
| SMILES | CNC(=O)N[C@@H](C(C)C)C(C)(C)C |
| InChI | InChI=1S/C10H22N2O/c1-7(2)8(10(3,4)5)12-9(13)11-6/h7-8H,1-6H3,(H2,11,12,13)/t8-/m0/s1 |
| InChIKey | SEQHYCRUUKIQEC-QMMMGPOBSA-N |
| XLogP | 1.99 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-methyl-3-[(3S)-2,2,4-trimethylpentan-3-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-[(3S)-2,2,4-trimethylpentan-3-yl]urea?
The IUPAC name of 1-methyl-3-[(3S)-2,2,4-trimethylpentan-3-yl]urea (CID 58468761) is 1-methyl-3-[(3S)-2,2,4-trimethylpentan-3-yl]urea.
What is the SMILES notation for 1-methyl-3-[(3S)-2,2,4-trimethylpentan-3-yl]urea?
The canonical SMILES for 1-methyl-3-[(3S)-2,2,4-trimethylpentan-3-yl]urea is CNC(=O)N[C@@H](C(C)C)C(C)(C)C.
What is the InChIKey of 1-methyl-3-[(3S)-2,2,4-trimethylpentan-3-yl]urea?
The InChIKey is SEQHYCRUUKIQEC-QMMMGPOBSA-N. The full InChI is InChI=1S/C10H22N2O/c1-7(2)8(10(3,4)5)12-9(13)11-6/h7-8H,1-6H3,(H2,11,12,13)/t8-/m0/s1.
What are the key properties of 1-methyl-3-[(3S)-2,2,4-trimethylpentan-3-yl]urea?
1-methyl-3-[(3S)-2,2,4-trimethylpentan-3-yl]urea has a molecular weight of 186.30 g/mol, XLogP of 1.99, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-[(3S)-2,2,4-trimethylpentan-3-yl]urea is sourced from PubChem (CID 58468761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).