C11H22O2 — CID 58469090
(3S)-3-cyclobutyloxy-2,4-dimethylpentan-2-ol (PubChem CID 58469090) has the molecular formula C11H22O2 and a molecular weight of 186.29 g/mol. Its IUPAC name is (3S)-3-cyclobutyloxy-2,4-dimethylpentan-2-ol.
| Compound Name | (3S)-3-cyclobutyloxy-2,4-dimethylpentan-2-ol |
|---|---|
| PubChem CID | 58469090 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | (3S)-3-cyclobutyloxy-2,4-dimethylpentan-2-ol |
| SMILES | CC(C)[C@H](OC1CCC1)C(C)(C)O |
| InChI | InChI=1S/C11H22O2/c1-8(2)10(11(3,4)12)13-9-6-5-7-9/h8-10,12H,5-7H2,1-4H3/t10-/m0/s1 |
| InChIKey | ARXTXUNMHZTTAJ-JTQLQIEISA-N |
| XLogP | 2.35 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |