About (3S)-3-ethylsulfanyl-2,4-dimethylpentan-2-ol
(3S)-3-ethylsulfanyl-2,4-dimethylpentan-2-ol (PubChem CID 58469113) has the molecular formula C9H20OS
and a molecular weight of 176.32 g/mol. Its IUPAC name is (3S)-3-ethylsulfanyl-2,4-dimethylpentan-2-ol.
Molecular Properties
| Compound Name | (3S)-3-ethylsulfanyl-2,4-dimethylpentan-2-ol |
| PubChem CID | 58469113 |
| Molecular Formula | C9H20OS |
| Molecular Weight | 176.32 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | (3S)-3-ethylsulfanyl-2,4-dimethylpentan-2-ol |
| SMILES | CCS[C@@H](C(C)C)C(C)(C)O |
| InChI | InChI=1S/C9H20OS/c1-6-11-8(7(2)3)9(4,5)10/h7-8,10H,6H2,1-5H3/t8-/m0/s1 |
| InChIKey | CQOMGZOXEOJBGX-QMMMGPOBSA-N |
| XLogP | 2.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.32 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S)-3-ethylsulfanyl-2,4-dimethylpentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-ethylsulfanyl-2,4-dimethylpentan-2-ol?
The IUPAC name of (3S)-3-ethylsulfanyl-2,4-dimethylpentan-2-ol (CID 58469113) is (3S)-3-ethylsulfanyl-2,4-dimethylpentan-2-ol.
What is the SMILES notation for (3S)-3-ethylsulfanyl-2,4-dimethylpentan-2-ol?
The canonical SMILES for (3S)-3-ethylsulfanyl-2,4-dimethylpentan-2-ol is CCS[C@@H](C(C)C)C(C)(C)O.
What is the InChIKey of (3S)-3-ethylsulfanyl-2,4-dimethylpentan-2-ol?
The InChIKey is CQOMGZOXEOJBGX-QMMMGPOBSA-N. The full InChI is InChI=1S/C9H20OS/c1-6-11-8(7(2)3)9(4,5)10/h7-8,10H,6H2,1-5H3/t8-/m0/s1.
What are the key properties of (3S)-3-ethylsulfanyl-2,4-dimethylpentan-2-ol?
(3S)-3-ethylsulfanyl-2,4-dimethylpentan-2-ol has a molecular weight of 176.32 g/mol, XLogP of 2.54, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-ethylsulfanyl-2,4-dimethylpentan-2-ol is sourced from PubChem (CID 58469113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).