About (3S)-3-cyclopropyloxy-2,4-dimethylpentan-2-ol
(3S)-3-cyclopropyloxy-2,4-dimethylpentan-2-ol (PubChem CID 58469119) has the molecular formula C10H20O2
and a molecular weight of 172.27 g/mol. Its IUPAC name is (3S)-3-cyclopropyloxy-2,4-dimethylpentan-2-ol.
Molecular Properties
| Compound Name | (3S)-3-cyclopropyloxy-2,4-dimethylpentan-2-ol |
| PubChem CID | 58469119 |
| Molecular Formula | C10H20O2 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.15 |
| IUPAC Name | (3S)-3-cyclopropyloxy-2,4-dimethylpentan-2-ol |
| SMILES | CC(C)[C@H](OC1CC1)C(C)(C)O |
| InChI | InChI=1S/C10H20O2/c1-7(2)9(10(3,4)11)12-8-5-6-8/h7-9,11H,5-6H2,1-4H3/t9-/m0/s1 |
| InChIKey | YTFZKAZVCPQLLV-VIFPVBQESA-N |
| XLogP | 1.96 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S)-3-cyclopropyloxy-2,4-dimethylpentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-cyclopropyloxy-2,4-dimethylpentan-2-ol?
The IUPAC name of (3S)-3-cyclopropyloxy-2,4-dimethylpentan-2-ol (CID 58469119) is (3S)-3-cyclopropyloxy-2,4-dimethylpentan-2-ol.
What is the SMILES notation for (3S)-3-cyclopropyloxy-2,4-dimethylpentan-2-ol?
The canonical SMILES for (3S)-3-cyclopropyloxy-2,4-dimethylpentan-2-ol is CC(C)[C@H](OC1CC1)C(C)(C)O.
What is the InChIKey of (3S)-3-cyclopropyloxy-2,4-dimethylpentan-2-ol?
The InChIKey is YTFZKAZVCPQLLV-VIFPVBQESA-N. The full InChI is InChI=1S/C10H20O2/c1-7(2)9(10(3,4)11)12-8-5-6-8/h7-9,11H,5-6H2,1-4H3/t9-/m0/s1.
What are the key properties of (3S)-3-cyclopropyloxy-2,4-dimethylpentan-2-ol?
(3S)-3-cyclopropyloxy-2,4-dimethylpentan-2-ol has a molecular weight of 172.27 g/mol, XLogP of 1.96, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-cyclopropyloxy-2,4-dimethylpentan-2-ol is sourced from PubChem (CID 58469119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).