About (3S)-2,4-dimethyl-3-methylsulfonylpentan-2-ol
(3S)-2,4-dimethyl-3-methylsulfonylpentan-2-ol (PubChem CID 58469143) has the molecular formula C8H18O3S
and a molecular weight of 194.30 g/mol. Its IUPAC name is (3S)-2,4-dimethyl-3-methylsulfonylpentan-2-ol.
Molecular Properties
| Compound Name | (3S)-2,4-dimethyl-3-methylsulfonylpentan-2-ol |
| PubChem CID | 58469143 |
| Molecular Formula | C8H18O3S |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.10 |
| IUPAC Name | (3S)-2,4-dimethyl-3-methylsulfonylpentan-2-ol |
| SMILES | CC(C)[C@@H](C(C)(C)O)S(C)(=O)=O |
| InChI | InChI=1S/C8H18O3S/c1-6(2)7(8(3,4)9)12(5,10)11/h6-7,9H,1-5H3/t7-/m0/s1 |
| InChIKey | DMRVUJFAEVICHL-ZETCQYMHSA-N |
| XLogP | 0.83 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-2,4-dimethyl-3-methylsulfonylpentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-2,4-dimethyl-3-methylsulfonylpentan-2-ol?
The IUPAC name of (3S)-2,4-dimethyl-3-methylsulfonylpentan-2-ol (CID 58469143) is (3S)-2,4-dimethyl-3-methylsulfonylpentan-2-ol.
What is the SMILES notation for (3S)-2,4-dimethyl-3-methylsulfonylpentan-2-ol?
The canonical SMILES for (3S)-2,4-dimethyl-3-methylsulfonylpentan-2-ol is CC(C)[C@@H](C(C)(C)O)S(C)(=O)=O.
What is the InChIKey of (3S)-2,4-dimethyl-3-methylsulfonylpentan-2-ol?
The InChIKey is DMRVUJFAEVICHL-ZETCQYMHSA-N. The full InChI is InChI=1S/C8H18O3S/c1-6(2)7(8(3,4)9)12(5,10)11/h6-7,9H,1-5H3/t7-/m0/s1.
What are the key properties of (3S)-2,4-dimethyl-3-methylsulfonylpentan-2-ol?
(3S)-2,4-dimethyl-3-methylsulfonylpentan-2-ol has a molecular weight of 194.30 g/mol, XLogP of 0.83, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-2,4-dimethyl-3-methylsulfonylpentan-2-ol is sourced from PubChem (CID 58469143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).