C11H24N2O — CID 58469172
1,1-dimethyl-3-[(3S)-2,2,4-trimethylpentan-3-yl]urea (PubChem CID 58469172) has the molecular formula C11H24N2O and a molecular weight of 200.33 g/mol. Its IUPAC name is 1,1-dimethyl-3-[(3S)-2,2,4-trimethylpentan-3-yl]urea.
| Compound Name | 1,1-dimethyl-3-[(3S)-2,2,4-trimethylpentan-3-yl]urea |
|---|---|
| PubChem CID | 58469172 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | 1,1-dimethyl-3-[(3S)-2,2,4-trimethylpentan-3-yl]urea |
| SMILES | CC(C)[C@H](NC(=O)N(C)C)C(C)(C)C |
| InChI | InChI=1S/C11H24N2O/c1-8(2)9(11(3,4)5)12-10(14)13(6)7/h8-9H,1-7H3,(H,12,14)/t9-/m0/s1 |
| InChIKey | VILBDVJBFJKQOD-VIFPVBQESA-N |
| XLogP | 2.33 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |