About 2-methoxy-N-(4-methoxy-1,3-benzothiazol-2-yl)benzamide
2-methoxy-N-(4-methoxy-1,3-benzothiazol-2-yl)benzamide (PubChem CID 584692) has the molecular formula C16H14N2O3S
and a molecular weight of 314.37 g/mol. Its IUPAC name is 2-methoxy-N-(4-methoxy-1,3-benzothiazol-2-yl)benzamide.
Molecular Properties
| Compound Name | 2-methoxy-N-(4-methoxy-1,3-benzothiazol-2-yl)benzamide |
| PubChem CID | 584692 |
| Molecular Formula | C16H14N2O3S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 2-methoxy-N-(4-methoxy-1,3-benzothiazol-2-yl)benzamide |
| SMILES | COc1ccccc1C(=O)Nc1nc2c(OC)cccc2s1 |
| InChI | InChI=1S/C16H14N2O3S/c1-20-11-7-4-3-6-10(11)15(19)18-16-17-14-12(21-2)8-5-9-13(14)22-16/h3-9H,1-2H3,(H,17,18,19) |
| InChIKey | RNPLBPCNRPDEHG-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methoxy-N-(4-methoxy-1,3-benzothiazol-2-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-N-(4-methoxy-1,3-benzothiazol-2-yl)benzamide?
The IUPAC name of 2-methoxy-N-(4-methoxy-1,3-benzothiazol-2-yl)benzamide (CID 584692) is 2-methoxy-N-(4-methoxy-1,3-benzothiazol-2-yl)benzamide.
What is the SMILES notation for 2-methoxy-N-(4-methoxy-1,3-benzothiazol-2-yl)benzamide?
The canonical SMILES for 2-methoxy-N-(4-methoxy-1,3-benzothiazol-2-yl)benzamide is COc1ccccc1C(=O)Nc1nc2c(OC)cccc2s1.
What is the InChIKey of 2-methoxy-N-(4-methoxy-1,3-benzothiazol-2-yl)benzamide?
The InChIKey is RNPLBPCNRPDEHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O3S/c1-20-11-7-4-3-6-10(11)15(19)18-16-17-14-12(21-2)8-5-9-13(14)22-16/h3-9H,1-2H3,(H,17,18,19).
What are the key properties of 2-methoxy-N-(4-methoxy-1,3-benzothiazol-2-yl)benzamide?
2-methoxy-N-(4-methoxy-1,3-benzothiazol-2-yl)benzamide has a molecular weight of 314.37 g/mol, XLogP of 3.57, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-N-(4-methoxy-1,3-benzothiazol-2-yl)benzamide is sourced from PubChem (CID 584692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).