About 2,3-di(propan-2-yl)-3,4-dihydro-2H-thiopyran
2,3-di(propan-2-yl)-3,4-dihydro-2H-thiopyran (PubChem CID 58469207) has the molecular formula C11H20S
and a molecular weight of 184.35 g/mol. Its IUPAC name is 2,3-di(propan-2-yl)-3,4-dihydro-2H-thiopyran.
Molecular Properties
| Compound Name | 2,3-di(propan-2-yl)-3,4-dihydro-2H-thiopyran |
| PubChem CID | 58469207 |
| Molecular Formula | C11H20S |
| Molecular Weight | 184.35 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | 2,3-di(propan-2-yl)-3,4-dihydro-2H-thiopyran |
| SMILES | CC(C)C1CC=CSC1C(C)C |
| InChI | InChI=1S/C11H20S/c1-8(2)10-6-5-7-12-11(10)9(3)4/h5,7-11H,6H2,1-4H3 |
| InChIKey | MRFHMRIAHVDDOB-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.35 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3-di(propan-2-yl)-3,4-dihydro-2H-thiopyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-di(propan-2-yl)-3,4-dihydro-2H-thiopyran?
The IUPAC name of 2,3-di(propan-2-yl)-3,4-dihydro-2H-thiopyran (CID 58469207) is 2,3-di(propan-2-yl)-3,4-dihydro-2H-thiopyran.
What is the SMILES notation for 2,3-di(propan-2-yl)-3,4-dihydro-2H-thiopyran?
The canonical SMILES for 2,3-di(propan-2-yl)-3,4-dihydro-2H-thiopyran is CC(C)C1CC=CSC1C(C)C.
What is the InChIKey of 2,3-di(propan-2-yl)-3,4-dihydro-2H-thiopyran?
The InChIKey is MRFHMRIAHVDDOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20S/c1-8(2)10-6-5-7-12-11(10)9(3)4/h5,7-11H,6H2,1-4H3.
What are the key properties of 2,3-di(propan-2-yl)-3,4-dihydro-2H-thiopyran?
2,3-di(propan-2-yl)-3,4-dihydro-2H-thiopyran has a molecular weight of 184.35 g/mol, XLogP of 3.93, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-di(propan-2-yl)-3,4-dihydro-2H-thiopyran is sourced from PubChem (CID 58469207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).