C29H48O4 — CID 58469308
[(1S,4R,5R,6R,8R,10S,11R,12S,13R,16R,18S,21R)-11,18-dimethoxy-4,6,12,17,17-pentamethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-8-yl]methanol (PubChem CID 58469308) has the molecular formula C29H48O4 and a molecular weight of 460.70 g/mol. Its IUPAC name is [(1S,4R,5R,6R,8R,10S,11R,12S,13R,16R,18S,21R)-11,18-dimethoxy-4,6,12,17,17-pentamethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-8-yl]methanol.
| Compound Name | [(1S,4R,5R,6R,8R,10S,11R,12S,13R,16R,18S,21R)-11,18-dimethoxy-4,6,12,17,17-pentamethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-8-yl]methanol |
|---|---|
| PubChem CID | 58469308 |
| Molecular Formula | C29H48O4 |
| Molecular Weight | 460.70 g/mol |
| Exact Mass | 460.36 |
| IUPAC Name | [(1S,4R,5R,6R,8R,10S,11R,12S,13R,16R,18S,21R)-11,18-dimethoxy-4,6,12,17,17-pentamethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-8-yl]methanol |
| SMILES | CO[C@H]1CC[C@]23C[C@]24CC[C@]2(C)[C@@H]5[C@H](O[C@@H](CO)C[C@H]5C)[C@H](OC)[C@@]2(C)[C@@H]4CC[C@H]3C1(C)C |
| InChI | InChI=1S/C29H48O4/c1-17-14-18(15-30)33-23-22(17)26(4)12-13-29-16-28(29)11-10-21(31-6)25(2,3)19(28)8-9-20(29)27(26,5)24(23)32-7/h17-24,30H,8-16H2,1-7H3/t17-,18-,19+,20+,21+,22+,23+,24+,26-,27-,28-,29+/m1/s1 |
| InChIKey | JVKSSGXZYKBBBW-LMHTUSANSA-N |
| XLogP | 5.46 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.70 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |