About 2,3-di(propan-2-yl)-2,3-dihydrothiophene
2,3-di(propan-2-yl)-2,3-dihydrothiophene (PubChem CID 58469891) has the molecular formula C10H18S
and a molecular weight of 170.32 g/mol. Its IUPAC name is 2,3-di(propan-2-yl)-2,3-dihydrothiophene.
Molecular Properties
| Compound Name | 2,3-di(propan-2-yl)-2,3-dihydrothiophene |
| PubChem CID | 58469891 |
| Molecular Formula | C10H18S |
| Molecular Weight | 170.32 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 2,3-di(propan-2-yl)-2,3-dihydrothiophene |
| SMILES | CC(C)C1C=CSC1C(C)C |
| InChI | InChI=1S/C10H18S/c1-7(2)9-5-6-11-10(9)8(3)4/h5-10H,1-4H3 |
| InChIKey | ZZZVDCVTMAULLG-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.32 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3-di(propan-2-yl)-2,3-dihydrothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-di(propan-2-yl)-2,3-dihydrothiophene?
The IUPAC name of 2,3-di(propan-2-yl)-2,3-dihydrothiophene (CID 58469891) is 2,3-di(propan-2-yl)-2,3-dihydrothiophene.
What is the SMILES notation for 2,3-di(propan-2-yl)-2,3-dihydrothiophene?
The canonical SMILES for 2,3-di(propan-2-yl)-2,3-dihydrothiophene is CC(C)C1C=CSC1C(C)C.
What is the InChIKey of 2,3-di(propan-2-yl)-2,3-dihydrothiophene?
The InChIKey is ZZZVDCVTMAULLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18S/c1-7(2)9-5-6-11-10(9)8(3)4/h5-10H,1-4H3.
What are the key properties of 2,3-di(propan-2-yl)-2,3-dihydrothiophene?
2,3-di(propan-2-yl)-2,3-dihydrothiophene has a molecular weight of 170.32 g/mol, XLogP of 3.54, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-di(propan-2-yl)-2,3-dihydrothiophene is sourced from PubChem (CID 58469891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).