C15H13N3OS — CID 58470188
2-(6-phenyl-1,3-benzothiazol-2-yl)acetohydrazide (PubChem CID 58470188) has the molecular formula C15H13N3OS and a molecular weight of 283.36 g/mol. Its IUPAC name is 2-(6-phenyl-1,3-benzothiazol-2-yl)acetohydrazide.
| Compound Name | 2-(6-phenyl-1,3-benzothiazol-2-yl)acetohydrazide |
|---|---|
| PubChem CID | 58470188 |
| Molecular Formula | C15H13N3OS |
| Molecular Weight | 283.36 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 2-(6-phenyl-1,3-benzothiazol-2-yl)acetohydrazide |
| SMILES | NNC(=O)Cc1nc2ccc(-c3ccccc3)cc2s1 |
| InChI | InChI=1S/C15H13N3OS/c16-18-14(19)9-15-17-12-7-6-11(8-13(12)20-15)10-4-2-1-3-5-10/h1-8H,9,16H2,(H,18,19) |
| InChIKey | CWEXQLSWIJAASS-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.36 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|