C26H26N4O4S2 — CID 58470352
2-(4,6-diphenyl-1,3-benzothiazol-2-yl)-N-[2-[2-(methanesulfonamido)ethylamino]-2-oxoethyl]acetamide (PubChem CID 58470352) has the molecular formula C26H26N4O4S2 and a molecular weight of 522.65 g/mol. Its IUPAC name is 2-(4,6-diphenyl-1,3-benzothiazol-2-yl)-N-[2-[2-(methanesulfonamido)ethylamino]-2-oxoethyl]acetamide.
| Compound Name | 2-(4,6-diphenyl-1,3-benzothiazol-2-yl)-N-[2-[2-(methanesulfonamido)ethylamino]-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 58470352 |
| Molecular Formula | C26H26N4O4S2 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.14 |
| IUPAC Name | 2-(4,6-diphenyl-1,3-benzothiazol-2-yl)-N-[2-[2-(methanesulfonamido)ethylamino]-2-oxoethyl]acetamide |
| SMILES | CS(=O)(=O)NCCNC(=O)CNC(=O)Cc1nc2c(-c3ccccc3)cc(-c3ccccc3)cc2s1 |
| InChI | InChI=1S/C26H26N4O4S2/c1-36(33,34)29-13-12-27-24(32)17-28-23(31)16-25-30-26-21(19-10-6-3-7-11-19)14-20(15-22(26)35-25)18-8-4-2-5-9-18/h2-11,14-15,29H,12-13,16-17H2,1H3,(H,27,32)(H,28,31) |
| InChIKey | BEFWMLVYVBGQMK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|