About (2-amino-4,5-dibromophenyl) formate
(2-amino-4,5-dibromophenyl) formate (PubChem CID 58470919) has the molecular formula C7H5Br2NO2
and a molecular weight of 294.93 g/mol. Its IUPAC name is (2-amino-4,5-dibromophenyl) formate.
Molecular Properties
| Compound Name | (2-amino-4,5-dibromophenyl) formate |
| PubChem CID | 58470919 |
| Molecular Formula | C7H5Br2NO2 |
| Molecular Weight | 294.93 g/mol |
| Exact Mass | 292.87 |
| IUPAC Name | (2-amino-4,5-dibromophenyl) formate |
| SMILES | Nc1cc(Br)c(Br)cc1OC=O |
| InChI | InChI=1S/C7H5Br2NO2/c8-4-1-6(10)7(12-3-11)2-5(4)9/h1-3H,10H2 |
| InChIKey | JGGBWEVTYAEUOJ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.93 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (2-amino-4,5-dibromophenyl) formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-4,5-dibromophenyl) formate?
The IUPAC name of (2-amino-4,5-dibromophenyl) formate (CID 58470919) is (2-amino-4,5-dibromophenyl) formate.
What is the SMILES notation for (2-amino-4,5-dibromophenyl) formate?
The canonical SMILES for (2-amino-4,5-dibromophenyl) formate is Nc1cc(Br)c(Br)cc1OC=O.
What is the InChIKey of (2-amino-4,5-dibromophenyl) formate?
The InChIKey is JGGBWEVTYAEUOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5Br2NO2/c8-4-1-6(10)7(12-3-11)2-5(4)9/h1-3H,10H2.
What are the key properties of (2-amino-4,5-dibromophenyl) formate?
(2-amino-4,5-dibromophenyl) formate has a molecular weight of 294.93 g/mol, XLogP of 2.33, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-4,5-dibromophenyl) formate is sourced from PubChem (CID 58470919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).