About 2-(3-benzyl-2,3-dimethylphenanthro[9,10-b]pyrrol-1-ium-1-yl)ethyl formate
2-(3-benzyl-2,3-dimethylphenanthro[9,10-b]pyrrol-1-ium-1-yl)ethyl formate (PubChem CID 58471137) has the molecular formula C28H26NO2+
and a molecular weight of 408.52 g/mol. Its IUPAC name is 2-(3-benzyl-2,3-dimethylphenanthro[9,10-b]pyrrol-1-ium-1-yl)ethyl formate.
Molecular Properties
| Compound Name | 2-(3-benzyl-2,3-dimethylphenanthro[9,10-b]pyrrol-1-ium-1-yl)ethyl formate |
| PubChem CID | 58471137 |
| Molecular Formula | C28H26NO2+ |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 2-(3-benzyl-2,3-dimethylphenanthro[9,10-b]pyrrol-1-ium-1-yl)ethyl formate |
| SMILES | CC1=[N+](CCOC=O)c2c(c3ccccc3c3ccccc23)C1(C)Cc1ccccc1 |
| InChI | InChI=1S/C28H26NO2/c1-20-28(2,18-21-10-4-3-5-11-21)26-24-14-8-6-12-22(24)23-13-7-9-15-25(23)27(26)29(20)16-17-31-19-30/h3-15,19H,16-18H2,1-2H3/q+1 |
| InChIKey | OIRFDPCDTDSANS-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-benzyl-2,3-dimethylphenanthro[9,10-b]pyrrol-1-ium-1-yl)ethyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-benzyl-2,3-dimethylphenanthro[9,10-b]pyrrol-1-ium-1-yl)ethyl formate?
The IUPAC name of 2-(3-benzyl-2,3-dimethylphenanthro[9,10-b]pyrrol-1-ium-1-yl)ethyl formate (CID 58471137) is 2-(3-benzyl-2,3-dimethylphenanthro[9,10-b]pyrrol-1-ium-1-yl)ethyl formate.
What is the SMILES notation for 2-(3-benzyl-2,3-dimethylphenanthro[9,10-b]pyrrol-1-ium-1-yl)ethyl formate?
The canonical SMILES for 2-(3-benzyl-2,3-dimethylphenanthro[9,10-b]pyrrol-1-ium-1-yl)ethyl formate is CC1=[N+](CCOC=O)c2c(c3ccccc3c3ccccc23)C1(C)Cc1ccccc1.
What is the InChIKey of 2-(3-benzyl-2,3-dimethylphenanthro[9,10-b]pyrrol-1-ium-1-yl)ethyl formate?
The InChIKey is OIRFDPCDTDSANS-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H26NO2/c1-20-28(2,18-21-10-4-3-5-11-21)26-24-14-8-6-12-22(24)23-13-7-9-15-25(23)27(26)29(20)16-17-31-19-30/h3-15,19H,16-18H2,1-2H3/q+1.
What are the key properties of 2-(3-benzyl-2,3-dimethylphenanthro[9,10-b]pyrrol-1-ium-1-yl)ethyl formate?
2-(3-benzyl-2,3-dimethylphenanthro[9,10-b]pyrrol-1-ium-1-yl)ethyl formate has a molecular weight of 408.52 g/mol, XLogP of 5.78, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-benzyl-2,3-dimethylphenanthro[9,10-b]pyrrol-1-ium-1-yl)ethyl formate is sourced from PubChem (CID 58471137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).