About 2-(2,3,3-trimethylindol-1-ium-1-yl)ethyl formate
2-(2,3,3-trimethylindol-1-ium-1-yl)ethyl formate (PubChem CID 58471153) has the molecular formula C14H18NO2+
and a molecular weight of 232.30 g/mol. Its IUPAC name is 2-(2,3,3-trimethylindol-1-ium-1-yl)ethyl formate.
Molecular Properties
| Compound Name | 2-(2,3,3-trimethylindol-1-ium-1-yl)ethyl formate |
| PubChem CID | 58471153 |
| Molecular Formula | C14H18NO2+ |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 2-(2,3,3-trimethylindol-1-ium-1-yl)ethyl formate |
| SMILES | CC1=[N+](CCOC=O)c2ccccc2C1(C)C |
| InChI | InChI=1S/C14H18NO2/c1-11-14(2,3)12-6-4-5-7-13(12)15(11)8-9-17-10-16/h4-7,10H,8-9H2,1-3H3/q+1 |
| InChIKey | QNRNTOAFOCZQPK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,3,3-trimethylindol-1-ium-1-yl)ethyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3,3-trimethylindol-1-ium-1-yl)ethyl formate?
The IUPAC name of 2-(2,3,3-trimethylindol-1-ium-1-yl)ethyl formate (CID 58471153) is 2-(2,3,3-trimethylindol-1-ium-1-yl)ethyl formate.
What is the SMILES notation for 2-(2,3,3-trimethylindol-1-ium-1-yl)ethyl formate?
The canonical SMILES for 2-(2,3,3-trimethylindol-1-ium-1-yl)ethyl formate is CC1=[N+](CCOC=O)c2ccccc2C1(C)C.
What is the InChIKey of 2-(2,3,3-trimethylindol-1-ium-1-yl)ethyl formate?
The InChIKey is QNRNTOAFOCZQPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18NO2/c1-11-14(2,3)12-6-4-5-7-13(12)15(11)8-9-17-10-16/h4-7,10H,8-9H2,1-3H3/q+1.
What are the key properties of 2-(2,3,3-trimethylindol-1-ium-1-yl)ethyl formate?
2-(2,3,3-trimethylindol-1-ium-1-yl)ethyl formate has a molecular weight of 232.30 g/mol, XLogP of 2.26, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3,3-trimethylindol-1-ium-1-yl)ethyl formate is sourced from PubChem (CID 58471153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).