C52H58N2 — CID 58471857
N-(2,6-dimethylphenyl)-N-[4-[1-[4-(N-(2,6-dimethylphenyl)-2,4,5-trimethylanilino)phenyl]cyclohexyl]phenyl]-2,4,5-trimethylaniline (PubChem CID 58471857) has the molecular formula C52H58N2 and a molecular weight of 711.05 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-N-[4-[1-[4-(N-(2,6-dimethylphenyl)-2,4,5-trimethylanilino)phenyl]cyclohexyl]phenyl]-2,4,5-trimethylaniline.
| Compound Name | N-(2,6-dimethylphenyl)-N-[4-[1-[4-(N-(2,6-dimethylphenyl)-2,4,5-trimethylanilino)phenyl]cyclohexyl]phenyl]-2,4,5-trimethylaniline |
|---|---|
| PubChem CID | 58471857 |
| Molecular Formula | C52H58N2 |
| Molecular Weight | 711.05 g/mol |
| Exact Mass | 710.46 |
| IUPAC Name | N-(2,6-dimethylphenyl)-N-[4-[1-[4-(N-(2,6-dimethylphenyl)-2,4,5-trimethylanilino)phenyl]cyclohexyl]phenyl]-2,4,5-trimethylaniline |
| SMILES | Cc1cc(C)c(N(c2ccc(C3(c4ccc(N(c5cc(C)c(C)cc5C)c5c(C)cccc5C)cc4)CCCCC3)cc2)c2c(C)cccc2C)cc1C |
| InChI | InChI=1S/C52H58N2/c1-34-16-14-17-35(2)50(34)53(48-32-40(7)38(5)30-42(48)9)46-24-20-44(21-25-46)52(28-12-11-13-29-52)45-22-26-47(27-23-45)54(51-36(3)18-15-19-37(51)4)49-33-41(8)39(6)31-43(49)10/h14-27,30-33H,11-13,28-29H2,1-10H3 |
| InChIKey | RLCALOIVUDZEFB-UHFFFAOYSA-N |
| XLogP | 14.96 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.05 |
| LogP ≤ 5 | 14.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |