About CID 58471883
CID 58471883 (PubChem CID 58471883) has the molecular formula C47H41IrN4OS
and a molecular weight of 902.16 g/mol.
Molecular Properties
| Compound Name | CID 58471883 |
| PubChem CID | 58471883 |
| Molecular Formula | C47H41IrN4OS |
| Molecular Weight | 902.16 g/mol |
| Exact Mass | 902.26 |
| IUPAC Name | — |
| SMILES | CC(C)c1cccc(C(C)C)c1-n1ccnc1-c1[c-]cccc1.CC1(C)c2cccc3c2N([CH-]N3c2cccs2)c2[c-]cc3c(oc4ccccc43)c21.[Ir+3] |
| InChI | InChI=1S/C26H18N2OS.C21H23N2.Ir/c1-26(2)18-8-5-9-20-24(18)28(15-27(20)22-11-6-14-30-22)19-13-12-17-16-7-3-4-10-21(16)29-25(17)23(19)26;1-15(2)18-11-8-12-19(16(3)4)20(18)23-14-13-22-21(23)17-9-6-5-7-10-17;/h3-12,14-15H,1-2H3;5-9,11-16H,1-4H3;/q-2;-1;+3 |
| InChIKey | LAQIRGAKFOTMAM-UHFFFAOYSA-N |
| XLogP | 13.08 |
| TPSA | 37.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 902.16 |
| LogP ≤ 5 | 13.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 58471883 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58471883?
The IUPAC name of CID 58471883 (CID 58471883) is not available.
What is the SMILES notation for CID 58471883?
The canonical SMILES for CID 58471883 is CC(C)c1cccc(C(C)C)c1-n1ccnc1-c1[c-]cccc1.CC1(C)c2cccc3c2N([CH-]N3c2cccs2)c2[c-]cc3c(oc4ccccc43)c21.[Ir+3].
What is the InChIKey of CID 58471883?
The InChIKey is LAQIRGAKFOTMAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H18N2OS.C21H23N2.Ir/c1-26(2)18-8-5-9-20-24(18)28(15-27(20)22-11-6-14-30-22)19-13-12-17-16-7-3-4-10-21(16)29-25(17)23(19)26;1-15(2)18-11-8-12-19(16(3)4)20(18)23-14-13-22-21(23)17-9-6-5-7-10-17;/h3-12,14-15H,1-2H3;5-9,11-16H,1-4H3;/q-2;-1;+3.
What are the key properties of CID 58471883?
CID 58471883 has a molecular weight of 902.16 g/mol, XLogP of 13.08, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58471883 is sourced from PubChem (CID 58471883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).