About CID 58471927
CID 58471927 (PubChem CID 58471927) has the molecular formula C44H41IrN4S
and a molecular weight of 850.12 g/mol.
Molecular Properties
| Compound Name | CID 58471927 |
| PubChem CID | 58471927 |
| Molecular Formula | C44H41IrN4S |
| Molecular Weight | 850.12 g/mol |
| Exact Mass | 850.27 |
| IUPAC Name | — |
| SMILES | CC(C)c1cccc(C(C)C)c1-n1ccnc1-c1[c-]cccc1.CN1[CH-]N2c3[c-]cc4c(sc5ccccc54)c3C(C)(C)c3cccc1c32.[Ir+3] |
| InChI | InChI=1S/C23H18N2S.C21H23N2.Ir/c1-23(2)16-8-6-9-18-21(16)25(13-24(18)3)17-12-11-15-14-7-4-5-10-19(14)26-22(15)20(17)23;1-15(2)18-11-8-12-19(16(3)4)20(18)23-14-13-22-21(23)17-9-6-5-7-10-17;/h4-11,13H,1-3H3;5-9,11-16H,1-4H3;/q-2;-1;+3 |
| InChIKey | QLXRFFQDWCRHDD-UHFFFAOYSA-N |
| XLogP | 11.78 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 850.12 |
| LogP ≤ 5 | 11.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 58471927 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58471927?
The IUPAC name of CID 58471927 (CID 58471927) is not available.
What is the SMILES notation for CID 58471927?
The canonical SMILES for CID 58471927 is CC(C)c1cccc(C(C)C)c1-n1ccnc1-c1[c-]cccc1.CN1[CH-]N2c3[c-]cc4c(sc5ccccc54)c3C(C)(C)c3cccc1c32.[Ir+3].
What is the InChIKey of CID 58471927?
The InChIKey is QLXRFFQDWCRHDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18N2S.C21H23N2.Ir/c1-23(2)16-8-6-9-18-21(16)25(13-24(18)3)17-12-11-15-14-7-4-5-10-19(14)26-22(15)20(17)23;1-15(2)18-11-8-12-19(16(3)4)20(18)23-14-13-22-21(23)17-9-6-5-7-10-17;/h4-11,13H,1-3H3;5-9,11-16H,1-4H3;/q-2;-1;+3.
What are the key properties of CID 58471927?
CID 58471927 has a molecular weight of 850.12 g/mol, XLogP of 11.78, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58471927 is sourced from PubChem (CID 58471927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).