About 4-(2,2-difluoropropoxycarbonyl)-2,2-dimethylhexanoic acid
4-(2,2-difluoropropoxycarbonyl)-2,2-dimethylhexanoic acid (PubChem CID 58472063) has the molecular formula C12H20F2O4
and a molecular weight of 266.28 g/mol. Its IUPAC name is 4-(2,2-difluoropropoxycarbonyl)-2,2-dimethylhexanoic acid.
Molecular Properties
| Compound Name | 4-(2,2-difluoropropoxycarbonyl)-2,2-dimethylhexanoic acid |
| PubChem CID | 58472063 |
| Molecular Formula | C12H20F2O4 |
| Molecular Weight | 266.28 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 4-(2,2-difluoropropoxycarbonyl)-2,2-dimethylhexanoic acid |
| SMILES | CCC(CC(C)(C)C(=O)O)C(=O)OCC(C)(F)F |
| InChI | InChI=1S/C12H20F2O4/c1-5-8(6-11(2,3)10(16)17)9(15)18-7-12(4,13)14/h8H,5-7H2,1-4H3,(H,16,17) |
| InChIKey | KFVAAGSTUFLUAH-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.28 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2,2-difluoropropoxycarbonyl)-2,2-dimethylhexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,2-difluoropropoxycarbonyl)-2,2-dimethylhexanoic acid?
The IUPAC name of 4-(2,2-difluoropropoxycarbonyl)-2,2-dimethylhexanoic acid (CID 58472063) is 4-(2,2-difluoropropoxycarbonyl)-2,2-dimethylhexanoic acid.
What is the SMILES notation for 4-(2,2-difluoropropoxycarbonyl)-2,2-dimethylhexanoic acid?
The canonical SMILES for 4-(2,2-difluoropropoxycarbonyl)-2,2-dimethylhexanoic acid is CCC(CC(C)(C)C(=O)O)C(=O)OCC(C)(F)F.
What is the InChIKey of 4-(2,2-difluoropropoxycarbonyl)-2,2-dimethylhexanoic acid?
The InChIKey is KFVAAGSTUFLUAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20F2O4/c1-5-8(6-11(2,3)10(16)17)9(15)18-7-12(4,13)14/h8H,5-7H2,1-4H3,(H,16,17).
What are the key properties of 4-(2,2-difluoropropoxycarbonyl)-2,2-dimethylhexanoic acid?
4-(2,2-difluoropropoxycarbonyl)-2,2-dimethylhexanoic acid has a molecular weight of 266.28 g/mol, XLogP of 2.71, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2-difluoropropoxycarbonyl)-2,2-dimethylhexanoic acid is sourced from PubChem (CID 58472063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).