C34H53N3O18 — CID 58472348
[4,5,6-triacetyloxy-7-oxo-7-[2-[2-(2,3,4,5-tetraacetyloxyheptanoylamino)ethylamino]ethylamino]heptan-3-yl] acetate (PubChem CID 58472348) has the molecular formula C34H53N3O18 and a molecular weight of 791.80 g/mol. Its IUPAC name is [4,5,6-triacetyloxy-7-oxo-7-[2-[2-(2,3,4,5-tetraacetyloxyheptanoylamino)ethylamino]ethylamino]heptan-3-yl] acetate.
| Compound Name | [4,5,6-triacetyloxy-7-oxo-7-[2-[2-(2,3,4,5-tetraacetyloxyheptanoylamino)ethylamino]ethylamino]heptan-3-yl] acetate |
|---|---|
| PubChem CID | 58472348 |
| Molecular Formula | C34H53N3O18 |
| Molecular Weight | 791.80 g/mol |
| Exact Mass | 791.33 |
| IUPAC Name | [4,5,6-triacetyloxy-7-oxo-7-[2-[2-(2,3,4,5-tetraacetyloxyheptanoylamino)ethylamino]ethylamino]heptan-3-yl] acetate |
| SMILES | CCC(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C(=O)NCCNCCNC(=O)C(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C(CC)OC(C)=O |
| InChI | InChI=1S/C34H53N3O18/c1-11-25(48-17(3)38)27(50-19(5)40)29(52-21(7)42)31(54-23(9)44)33(46)36-15-13-35-14-16-37-34(47)32(55-24(10)45)30(53-22(8)43)28(51-20(6)41)26(12-2)49-18(4)39/h25-32,35H,11-16H2,1-10H3,(H,36,46)(H,37,47) |
| InChIKey | OXWOFJMFJNZISG-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 280.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.80 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|