C31H33FN2O4 — CID 58472875
5-[2-(3-aminopropoxy)-5-(4-methylpentanoyl)phenyl]-2-(4-fluorophenyl)-N-methyl-1-benzofuran-3-carboxamide (PubChem CID 58472875) has the molecular formula C31H33FN2O4 and a molecular weight of 516.61 g/mol. Its IUPAC name is 5-[2-(3-aminopropoxy)-5-(4-methylpentanoyl)phenyl]-2-(4-fluorophenyl)-N-methyl-1-benzofuran-3-carboxamide.
| Compound Name | 5-[2-(3-aminopropoxy)-5-(4-methylpentanoyl)phenyl]-2-(4-fluorophenyl)-N-methyl-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 58472875 |
| Molecular Formula | C31H33FN2O4 |
| Molecular Weight | 516.61 g/mol |
| Exact Mass | 516.24 |
| IUPAC Name | 5-[2-(3-aminopropoxy)-5-(4-methylpentanoyl)phenyl]-2-(4-fluorophenyl)-N-methyl-1-benzofuran-3-carboxamide |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2ccc(-c3cc(C(=O)CCC(C)C)ccc3OCCCN)cc12 |
| InChI | InChI=1S/C31H33FN2O4/c1-19(2)5-12-26(35)22-9-13-27(37-16-4-15-33)24(18-22)21-8-14-28-25(17-21)29(31(36)34-3)30(38-28)20-6-10-23(32)11-7-20/h6-11,13-14,17-19H,4-5,12,15-16,33H2,1-3H3,(H,34,36) |
| InChIKey | ILHVCELJCUVRMS-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.61 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|