C33H36F3N5O2 — CID 58473018
benzyl (3R,4R)-3-[[[(1R)-1-[2-benzyl-5-(2,5-difluorophenyl)-1,2,4-triazol-3-yl]-2,2-dimethylpropyl]amino]methyl]-4-fluoropyrrolidine-1-carboxylate (PubChem CID 58473018) has the molecular formula C33H36F3N5O2 and a molecular weight of 591.68 g/mol. Its IUPAC name is benzyl (3R,4R)-3-[[[(1R)-1-[2-benzyl-5-(2,5-difluorophenyl)-1,2,4-triazol-3-yl]-2,2-dimethylpropyl]amino]methyl]-4-fluoropyrrolidine-1-carboxylate.
| Compound Name | benzyl (3R,4R)-3-[[[(1R)-1-[2-benzyl-5-(2,5-difluorophenyl)-1,2,4-triazol-3-yl]-2,2-dimethylpropyl]amino]methyl]-4-fluoropyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 58473018 |
| Molecular Formula | C33H36F3N5O2 |
| Molecular Weight | 591.68 g/mol |
| Exact Mass | 591.28 |
| IUPAC Name | benzyl (3R,4R)-3-[[[(1R)-1-[2-benzyl-5-(2,5-difluorophenyl)-1,2,4-triazol-3-yl]-2,2-dimethylpropyl]amino]methyl]-4-fluoropyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)[C@@H](NC[C@@H]1CN(C(=O)OCc2ccccc2)C[C@@H]1F)c1nc(-c2cc(F)ccc2F)nn1Cc1ccccc1 |
| InChI | InChI=1S/C33H36F3N5O2/c1-33(2,3)29(37-17-24-19-40(20-28(24)36)32(42)43-21-23-12-8-5-9-13-23)31-38-30(26-16-25(34)14-15-27(26)35)39-41(31)18-22-10-6-4-7-11-22/h4-16,24,28-29,37H,17-21H2,1-3H3/t24-,28+,29+/m1/s1 |
| InChIKey | ADVQAEGPTUZJAS-MHZHKKNFSA-N |
| XLogP | 6.56 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.68 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |