C19H27F2N3O3 — CID 58473051
tert-butyl N-[(3R)-1-[[amino-(2,5-difluorophenyl)methylidene]amino]-4,4-dimethyl-2-oxopentan-3-yl]carbamate (PubChem CID 58473051) has the molecular formula C19H27F2N3O3 and a molecular weight of 383.44 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-[[amino-(2,5-difluorophenyl)methylidene]amino]-4,4-dimethyl-2-oxopentan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-[[amino-(2,5-difluorophenyl)methylidene]amino]-4,4-dimethyl-2-oxopentan-3-yl]carbamate |
|---|---|
| PubChem CID | 58473051 |
| Molecular Formula | C19H27F2N3O3 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | tert-butyl N-[(3R)-1-[[amino-(2,5-difluorophenyl)methylidene]amino]-4,4-dimethyl-2-oxopentan-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C(=O)C/N=C(\N)c1cc(F)ccc1F)C(C)(C)C |
| InChI | InChI=1S/C19H27F2N3O3/c1-18(2,3)15(24-17(26)27-19(4,5)6)14(25)10-23-16(22)12-9-11(20)7-8-13(12)21/h7-9,15H,10H2,1-6H3,(H2,22,23)(H,24,26)/t15-/m0/s1 |
| InChIKey | YQGVCXWAOWHRNL-HNNXBMFYSA-N |
| XLogP | 3.18 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|