About (3R,4R)-3-(2,2-dimethylpropyl)-4-fluoropyrrolidine
(3R,4R)-3-(2,2-dimethylpropyl)-4-fluoropyrrolidine (PubChem CID 58473063) has the molecular formula C9H18FN
and a molecular weight of 159.25 g/mol. Its IUPAC name is (3R,4R)-3-(2,2-dimethylpropyl)-4-fluoropyrrolidine.
Molecular Properties
| Compound Name | (3R,4R)-3-(2,2-dimethylpropyl)-4-fluoropyrrolidine |
| PubChem CID | 58473063 |
| Molecular Formula | C9H18FN |
| Molecular Weight | 159.25 g/mol |
| Exact Mass | 159.14 |
| IUPAC Name | (3R,4R)-3-(2,2-dimethylpropyl)-4-fluoropyrrolidine |
| SMILES | CC(C)(C)C[C@@H]1CNC[C@@H]1F |
| InChI | InChI=1S/C9H18FN/c1-9(2,3)4-7-5-11-6-8(7)10/h7-8,11H,4-6H2,1-3H3/t7-,8+/m1/s1 |
| InChIKey | FSRXYJQNHMHWTF-SFYZADRCSA-N |
| XLogP | 1.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.25 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3R,4R)-3-(2,2-dimethylpropyl)-4-fluoropyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4R)-3-(2,2-dimethylpropyl)-4-fluoropyrrolidine?
The IUPAC name of (3R,4R)-3-(2,2-dimethylpropyl)-4-fluoropyrrolidine (CID 58473063) is (3R,4R)-3-(2,2-dimethylpropyl)-4-fluoropyrrolidine.
What is the SMILES notation for (3R,4R)-3-(2,2-dimethylpropyl)-4-fluoropyrrolidine?
The canonical SMILES for (3R,4R)-3-(2,2-dimethylpropyl)-4-fluoropyrrolidine is CC(C)(C)C[C@@H]1CNC[C@@H]1F.
What is the InChIKey of (3R,4R)-3-(2,2-dimethylpropyl)-4-fluoropyrrolidine?
The InChIKey is FSRXYJQNHMHWTF-SFYZADRCSA-N. The full InChI is InChI=1S/C9H18FN/c1-9(2,3)4-7-5-11-6-8(7)10/h7-8,11H,4-6H2,1-3H3/t7-,8+/m1/s1.
What are the key properties of (3R,4R)-3-(2,2-dimethylpropyl)-4-fluoropyrrolidine?
(3R,4R)-3-(2,2-dimethylpropyl)-4-fluoropyrrolidine has a molecular weight of 159.25 g/mol, XLogP of 1.98, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4R)-3-(2,2-dimethylpropyl)-4-fluoropyrrolidine is sourced from PubChem (CID 58473063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).