C43H74O4 — CID 58473238
1-[5-acetyl-2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]ethanone (PubChem CID 58473238) has the molecular formula C43H74O4 and a molecular weight of 655.06 g/mol. Its IUPAC name is 1-[5-acetyl-2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]ethanone.
| Compound Name | 1-[5-acetyl-2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]ethanone |
|---|---|
| PubChem CID | 58473238 |
| Molecular Formula | C43H74O4 |
| Molecular Weight | 655.06 g/mol |
| Exact Mass | 654.56 |
| IUPAC Name | 1-[5-acetyl-2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]ethanone |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC1(CCCCCCCC/C=C\C/C=C\CCCCC)OC(C(C)=O)C(C(C)=O)O1 |
| InChI | InChI=1S/C43H74O4/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-43(46-41(39(3)44)42(47-43)40(4)45)38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22,41-42H,5-12,17-18,23-38H2,1-4H3/b15-13-,16-14-,21-19-,22-20- |
| InChIKey | HUEWSVCGWQUISB-KWXKLSQISA-N |
| XLogP | 13.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.06 |
| LogP ≤ 5 | 13.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|