C52H69NO10 — CID 58473691
tert-butyl 3-[2-[4-[7-[4-(4-acetamidobutoxy)phenyl]-9,9-bis[3-(2-methoxyethoxy)propyl]fluoren-2-yl]phenoxy]ethoxy]propanoate (PubChem CID 58473691) has the molecular formula C52H69NO10 and a molecular weight of 868.12 g/mol. Its IUPAC name is tert-butyl 3-[2-[4-[7-[4-(4-acetamidobutoxy)phenyl]-9,9-bis[3-(2-methoxyethoxy)propyl]fluoren-2-yl]phenoxy]ethoxy]propanoate.
| Compound Name | tert-butyl 3-[2-[4-[7-[4-(4-acetamidobutoxy)phenyl]-9,9-bis[3-(2-methoxyethoxy)propyl]fluoren-2-yl]phenoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 58473691 |
| Molecular Formula | C52H69NO10 |
| Molecular Weight | 868.12 g/mol |
| Exact Mass | 867.49 |
| IUPAC Name | tert-butyl 3-[2-[4-[7-[4-(4-acetamidobutoxy)phenyl]-9,9-bis[3-(2-methoxyethoxy)propyl]fluoren-2-yl]phenoxy]ethoxy]propanoate |
| SMILES | COCCOCCCC1(CCCOCCOC)c2cc(-c3ccc(OCCCCNC(C)=O)cc3)ccc2-c2ccc(-c3ccc(OCCOCCC(=O)OC(C)(C)C)cc3)cc21 |
| InChI | InChI=1S/C52H69NO10/c1-39(54)53-26-7-8-29-61-44-17-11-40(12-18-44)42-15-21-46-47-22-16-43(41-13-19-45(20-14-41)62-36-35-60-30-23-50(55)63-51(2,3)4)38-49(47)52(48(46)37-42,24-9-27-58-33-31-56-5)25-10-28-59-34-32-57-6/h11-22,37-38H,7-10,23-36H2,1-6H3,(H,53,54) |
| InChIKey | AQZJTRBTGSKLFM-UHFFFAOYSA-N |
| XLogP | 9.60 |
| TPSA | 120.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 868.12 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|