About [2-[4-(3,3-dimethylbutyl)piperazin-1-yl]-2-oxoethyl] acetate
[2-[4-(3,3-dimethylbutyl)piperazin-1-yl]-2-oxoethyl] acetate (PubChem CID 58474437) has the molecular formula C14H26N2O3
and a molecular weight of 270.37 g/mol. Its IUPAC name is [2-[4-(3,3-dimethylbutyl)piperazin-1-yl]-2-oxoethyl] acetate.
Molecular Properties
| Compound Name | [2-[4-(3,3-dimethylbutyl)piperazin-1-yl]-2-oxoethyl] acetate |
| PubChem CID | 58474437 |
| Molecular Formula | C14H26N2O3 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | [2-[4-(3,3-dimethylbutyl)piperazin-1-yl]-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)N1CCN(CCC(C)(C)C)CC1 |
| InChI | InChI=1S/C14H26N2O3/c1-12(17)19-11-13(18)16-9-7-15(8-10-16)6-5-14(2,3)4/h5-11H2,1-4H3 |
| InChIKey | HYMNDMRBEJFZSX-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-[4-(3,3-dimethylbutyl)piperazin-1-yl]-2-oxoethyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[4-(3,3-dimethylbutyl)piperazin-1-yl]-2-oxoethyl] acetate?
The IUPAC name of [2-[4-(3,3-dimethylbutyl)piperazin-1-yl]-2-oxoethyl] acetate (CID 58474437) is [2-[4-(3,3-dimethylbutyl)piperazin-1-yl]-2-oxoethyl] acetate.
What is the SMILES notation for [2-[4-(3,3-dimethylbutyl)piperazin-1-yl]-2-oxoethyl] acetate?
The canonical SMILES for [2-[4-(3,3-dimethylbutyl)piperazin-1-yl]-2-oxoethyl] acetate is CC(=O)OCC(=O)N1CCN(CCC(C)(C)C)CC1.
What is the InChIKey of [2-[4-(3,3-dimethylbutyl)piperazin-1-yl]-2-oxoethyl] acetate?
The InChIKey is HYMNDMRBEJFZSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2O3/c1-12(17)19-11-13(18)16-9-7-15(8-10-16)6-5-14(2,3)4/h5-11H2,1-4H3.
What are the key properties of [2-[4-(3,3-dimethylbutyl)piperazin-1-yl]-2-oxoethyl] acetate?
[2-[4-(3,3-dimethylbutyl)piperazin-1-yl]-2-oxoethyl] acetate has a molecular weight of 270.37 g/mol, XLogP of 1.13, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[4-(3,3-dimethylbutyl)piperazin-1-yl]-2-oxoethyl] acetate is sourced from PubChem (CID 58474437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).