C16H17ClN6 — CID 58475453
8-chloro-4-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-[1,2,4]triazolo[4,3-a]quinoxaline (PubChem CID 58475453) has the molecular formula C16H17ClN6 and a molecular weight of 328.81 g/mol. Its IUPAC name is 8-chloro-4-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-[1,2,4]triazolo[4,3-a]quinoxaline.
| Compound Name | 8-chloro-4-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-[1,2,4]triazolo[4,3-a]quinoxaline |
|---|---|
| PubChem CID | 58475453 |
| Molecular Formula | C16H17ClN6 |
| Molecular Weight | 328.81 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 8-chloro-4-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-[1,2,4]triazolo[4,3-a]quinoxaline |
| SMILES | CN1CC2CN(c3nc4ccc(Cl)cc4n4cnnc34)CC2C1 |
| InChI | InChI=1S/C16H17ClN6/c1-21-5-10-7-22(8-11(10)6-21)15-16-20-18-9-23(16)14-4-12(17)2-3-13(14)19-15/h2-4,9-11H,5-8H2,1H3 |
| InChIKey | ARZWLBLDEQTPLQ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 49.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.81 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |