About 7-fluoro-8-isocyano-2-methyl-4-(4-methylpiperazin-1-yl)-[1,3]oxazolo[4,5-c]quinoline
7-fluoro-8-isocyano-2-methyl-4-(4-methylpiperazin-1-yl)-[1,3]oxazolo[4,5-c]quinoline (PubChem CID 58476071) has the molecular formula C17H16FN5O
and a molecular weight of 325.35 g/mol. Its IUPAC name is 7-fluoro-8-isocyano-2-methyl-4-(4-methylpiperazin-1-yl)-[1,3]oxazolo[4,5-c]quinoline.
Molecular Properties
| Compound Name | 7-fluoro-8-isocyano-2-methyl-4-(4-methylpiperazin-1-yl)-[1,3]oxazolo[4,5-c]quinoline |
| PubChem CID | 58476071 |
| Molecular Formula | C17H16FN5O |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 7-fluoro-8-isocyano-2-methyl-4-(4-methylpiperazin-1-yl)-[1,3]oxazolo[4,5-c]quinoline |
| SMILES | [C-]#[N+]c1cc2c(cc1F)nc(N1CCN(C)CC1)c1nc(C)oc12 |
| InChI | InChI=1S/C17H16FN5O/c1-10-20-15-16(24-10)11-8-14(19-2)12(18)9-13(11)21-17(15)23-6-4-22(3)5-7-23/h8-9H,4-7H2,1,3H3 |
| InChIKey | TYZRQFQKMRHHOJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 49.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 7-fluoro-8-isocyano-2-methyl-4-(4-methylpiperazin-1-yl)-[1,3]oxazolo[4,5-c]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-8-isocyano-2-methyl-4-(4-methylpiperazin-1-yl)-[1,3]oxazolo[4,5-c]quinoline?
The IUPAC name of 7-fluoro-8-isocyano-2-methyl-4-(4-methylpiperazin-1-yl)-[1,3]oxazolo[4,5-c]quinoline (CID 58476071) is 7-fluoro-8-isocyano-2-methyl-4-(4-methylpiperazin-1-yl)-[1,3]oxazolo[4,5-c]quinoline.
What is the SMILES notation for 7-fluoro-8-isocyano-2-methyl-4-(4-methylpiperazin-1-yl)-[1,3]oxazolo[4,5-c]quinoline?
The canonical SMILES for 7-fluoro-8-isocyano-2-methyl-4-(4-methylpiperazin-1-yl)-[1,3]oxazolo[4,5-c]quinoline is [C-]#[N+]c1cc2c(cc1F)nc(N1CCN(C)CC1)c1nc(C)oc12.
What is the InChIKey of 7-fluoro-8-isocyano-2-methyl-4-(4-methylpiperazin-1-yl)-[1,3]oxazolo[4,5-c]quinoline?
The InChIKey is TYZRQFQKMRHHOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16FN5O/c1-10-20-15-16(24-10)11-8-14(19-2)12(18)9-13(11)21-17(15)23-6-4-22(3)5-7-23/h8-9H,4-7H2,1,3H3.
What are the key properties of 7-fluoro-8-isocyano-2-methyl-4-(4-methylpiperazin-1-yl)-[1,3]oxazolo[4,5-c]quinoline?
7-fluoro-8-isocyano-2-methyl-4-(4-methylpiperazin-1-yl)-[1,3]oxazolo[4,5-c]quinoline has a molecular weight of 325.35 g/mol, XLogP of 3.13, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-8-isocyano-2-methyl-4-(4-methylpiperazin-1-yl)-[1,3]oxazolo[4,5-c]quinoline is sourced from PubChem (CID 58476071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).