C13H14ClN7 — CID 58476092
9-chloro-4-piperazin-1-yl-[1,2,4]triazolo[4,3-a]quinoxalin-8-amine (PubChem CID 58476092) has the molecular formula C13H14ClN7 and a molecular weight of 303.76 g/mol. Its IUPAC name is 9-chloro-4-piperazin-1-yl-[1,2,4]triazolo[4,3-a]quinoxalin-8-amine.
| Compound Name | 9-chloro-4-piperazin-1-yl-[1,2,4]triazolo[4,3-a]quinoxalin-8-amine |
|---|---|
| PubChem CID | 58476092 |
| Molecular Formula | C13H14ClN7 |
| Molecular Weight | 303.76 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 9-chloro-4-piperazin-1-yl-[1,2,4]triazolo[4,3-a]quinoxalin-8-amine |
| SMILES | Nc1ccc2nc(N3CCNCC3)c3nncn3c2c1Cl |
| InChI | InChI=1S/C13H14ClN7/c14-10-8(15)1-2-9-11(10)21-7-17-19-13(21)12(18-9)20-5-3-16-4-6-20/h1-2,7,16H,3-6,15H2 |
| InChIKey | CAIJHTLFGACGRI-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 84.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.76 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|