C28H42N2O5S2 — CID 58476121
[(2S,5S)-9-[8-(dithiolan-3-yl)-4-oxooctoxy]-1-methyl-3-oxo-2-propan-2-yl-2,4,5,6-tetrahydro-1,4-benzodiazocin-5-yl]methyl acetate (PubChem CID 58476121) has the molecular formula C28H42N2O5S2 and a molecular weight of 550.79 g/mol. Its IUPAC name is [(2S,5S)-9-[8-(dithiolan-3-yl)-4-oxooctoxy]-1-methyl-3-oxo-2-propan-2-yl-2,4,5,6-tetrahydro-1,4-benzodiazocin-5-yl]methyl acetate.
| Compound Name | [(2S,5S)-9-[8-(dithiolan-3-yl)-4-oxooctoxy]-1-methyl-3-oxo-2-propan-2-yl-2,4,5,6-tetrahydro-1,4-benzodiazocin-5-yl]methyl acetate |
|---|---|
| PubChem CID | 58476121 |
| Molecular Formula | C28H42N2O5S2 |
| Molecular Weight | 550.79 g/mol |
| Exact Mass | 550.25 |
| IUPAC Name | [(2S,5S)-9-[8-(dithiolan-3-yl)-4-oxooctoxy]-1-methyl-3-oxo-2-propan-2-yl-2,4,5,6-tetrahydro-1,4-benzodiazocin-5-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1Cc2ccc(OCCCC(=O)CCCCC3CCSS3)cc2N(C)[C@@H](C(C)C)C(=O)N1 |
| InChI | InChI=1S/C28H42N2O5S2/c1-19(2)27-28(33)29-22(18-35-20(3)31)16-21-11-12-24(17-26(21)30(27)4)34-14-7-9-23(32)8-5-6-10-25-13-15-36-37-25/h11-12,17,19,22,25,27H,5-10,13-16,18H2,1-4H3,(H,29,33)/t22-,25?,27-/m0/s1 |
| InChIKey | LULIBBIMFZUQHX-UMQIIANQSA-N |
| XLogP | 5.19 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.79 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|