C23H25N3O4 — CID 58476260
3,3-dimethyl-2-[3-(4-methyl-2,3-dioxopiperazin-1-yl)phenyl]-2,4-dihydro-1H-quinoline-6-carboxylic acid (PubChem CID 58476260) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is 3,3-dimethyl-2-[3-(4-methyl-2,3-dioxopiperazin-1-yl)phenyl]-2,4-dihydro-1H-quinoline-6-carboxylic acid.
| Compound Name | 3,3-dimethyl-2-[3-(4-methyl-2,3-dioxopiperazin-1-yl)phenyl]-2,4-dihydro-1H-quinoline-6-carboxylic acid |
|---|---|
| PubChem CID | 58476260 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 3,3-dimethyl-2-[3-(4-methyl-2,3-dioxopiperazin-1-yl)phenyl]-2,4-dihydro-1H-quinoline-6-carboxylic acid |
| SMILES | CN1CCN(c2cccc(C3Nc4ccc(C(=O)O)cc4CC3(C)C)c2)C(=O)C1=O |
| InChI | InChI=1S/C23H25N3O4/c1-23(2)13-16-11-15(22(29)30)7-8-18(16)24-19(23)14-5-4-6-17(12-14)26-10-9-25(3)20(27)21(26)28/h4-8,11-12,19,24H,9-10,13H2,1-3H3,(H,29,30) |
| InChIKey | HKPSHNAOAFGAMG-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|