C24H19F3N4O4 — CID 58476522
(8'Z)-5,6,7-trifluoro-8'-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]spiro[2H-1-benzofuran-3,3'-5,6-dihydro-[1,2,4]oxadiazolo[3,4-c][1,4]oxazine] (PubChem CID 58476522) has the molecular formula C24H19F3N4O4 and a molecular weight of 484.43 g/mol. Its IUPAC name is (8'Z)-5,6,7-trifluoro-8'-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]spiro[2H-1-benzofuran-3,3'-5,6-dihydro-[1,2,4]oxadiazolo[3,4-c][1,4]oxazine].
| Compound Name | (8'Z)-5,6,7-trifluoro-8'-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]spiro[2H-1-benzofuran-3,3'-5,6-dihydro-[1,2,4]oxadiazolo[3,4-c][1,4]oxazine] |
|---|---|
| PubChem CID | 58476522 |
| Molecular Formula | C24H19F3N4O4 |
| Molecular Weight | 484.43 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | (8'Z)-5,6,7-trifluoro-8'-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]spiro[2H-1-benzofuran-3,3'-5,6-dihydro-[1,2,4]oxadiazolo[3,4-c][1,4]oxazine] |
| SMILES | COc1cc(/C=C2\OCCN3C2=NOC32COc3c2cc(F)c(F)c3F)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C24H19F3N4O4/c1-13-10-30(12-28-13)17-4-3-14(7-18(17)32-2)8-19-23-29-35-24(31(23)5-6-33-19)11-34-22-15(24)9-16(25)20(26)21(22)27/h3-4,7-10,12H,5-6,11H2,1-2H3/b19-8- |
| InChIKey | YPSIEJGUIWPVOL-UWVJOHFNSA-N |
| XLogP | 3.87 |
| TPSA | 70.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.43 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|