C15H21N3O6 — CID 58476912
8-O-tert-butyl 2-O-methyl 3-hydroxy-4-oxo-6,7,9,10-tetrahydropyrimido[1,2-d][1,4]diazepine-2,8-dicarboxylate (PubChem CID 58476912) has the molecular formula C15H21N3O6 and a molecular weight of 339.35 g/mol. Its IUPAC name is 8-O-tert-butyl 2-O-methyl 3-hydroxy-4-oxo-6,7,9,10-tetrahydropyrimido[1,2-d][1,4]diazepine-2,8-dicarboxylate.
| Compound Name | 8-O-tert-butyl 2-O-methyl 3-hydroxy-4-oxo-6,7,9,10-tetrahydropyrimido[1,2-d][1,4]diazepine-2,8-dicarboxylate |
|---|---|
| PubChem CID | 58476912 |
| Molecular Formula | C15H21N3O6 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 8-O-tert-butyl 2-O-methyl 3-hydroxy-4-oxo-6,7,9,10-tetrahydropyrimido[1,2-d][1,4]diazepine-2,8-dicarboxylate |
| SMILES | COC(=O)c1nc2n(c(=O)c1O)CCN(C(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C15H21N3O6/c1-15(2,3)24-14(22)17-6-5-9-16-10(13(21)23-4)11(19)12(20)18(9)8-7-17/h19H,5-8H2,1-4H3 |
| InChIKey | FRNLONNJNPPQJQ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |