C11H19N — CID 58477023
2-[(1S)-2,2,3,3-tetramethylcyclopentyl]acetonitrile (PubChem CID 58477023) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is 2-[(1S)-2,2,3,3-tetramethylcyclopentyl]acetonitrile.
| Compound Name | 2-[(1S)-2,2,3,3-tetramethylcyclopentyl]acetonitrile |
|---|---|
| PubChem CID | 58477023 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | 2-[(1S)-2,2,3,3-tetramethylcyclopentyl]acetonitrile |
| SMILES | CC1(C)CC[C@@H](CC#N)C1(C)C |
| InChI | InChI=1S/C11H19N/c1-10(2)7-5-9(6-8-12)11(10,3)4/h9H,5-7H2,1-4H3/t9-/m0/s1 |
| InChIKey | QXTMWIGOWGSPIA-VIFPVBQESA-N |
| XLogP | 3.36 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |