About 2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]pyridine-4-carboxylic acid
2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]pyridine-4-carboxylic acid (PubChem CID 58477311) has the molecular formula C12H15NO5
and a molecular weight of 253.25 g/mol. Its IUPAC name is 2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]pyridine-4-carboxylic acid.
Molecular Properties
| Compound Name | 2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]pyridine-4-carboxylic acid |
| PubChem CID | 58477311 |
| Molecular Formula | C12H15NO5 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]pyridine-4-carboxylic acid |
| SMILES | CC1(C)OC[C@@H](COc2cc(C(=O)O)ccn2)O1 |
| InChI | InChI=1S/C12H15NO5/c1-12(2)17-7-9(18-12)6-16-10-5-8(11(14)15)3-4-13-10/h3-5,9H,6-7H2,1-2H3,(H,14,15)/t9-/m1/s1 |
| InChIKey | QDYRBGKATLITNW-SECBINFHSA-N |
| XLogP | 1.31 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]pyridine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]pyridine-4-carboxylic acid?
The IUPAC name of 2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]pyridine-4-carboxylic acid (CID 58477311) is 2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]pyridine-4-carboxylic acid.
What is the SMILES notation for 2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]pyridine-4-carboxylic acid?
The canonical SMILES for 2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]pyridine-4-carboxylic acid is CC1(C)OC[C@@H](COc2cc(C(=O)O)ccn2)O1.
What is the InChIKey of 2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]pyridine-4-carboxylic acid?
The InChIKey is QDYRBGKATLITNW-SECBINFHSA-N. The full InChI is InChI=1S/C12H15NO5/c1-12(2)17-7-9(18-12)6-16-10-5-8(11(14)15)3-4-13-10/h3-5,9H,6-7H2,1-2H3,(H,14,15)/t9-/m1/s1.
What are the key properties of 2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]pyridine-4-carboxylic acid?
2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]pyridine-4-carboxylic acid has a molecular weight of 253.25 g/mol, XLogP of 1.31, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]pyridine-4-carboxylic acid is sourced from PubChem (CID 58477311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).