About 4-[(E)-2-(3,4-dimethoxy-5-methylphenyl)ethenyl]-2-phenyl-1,3-thiazole
4-[(E)-2-(3,4-dimethoxy-5-methylphenyl)ethenyl]-2-phenyl-1,3-thiazole (PubChem CID 58477864) has the molecular formula C20H19NO2S
and a molecular weight of 337.44 g/mol. Its IUPAC name is 4-[(E)-2-(3,4-dimethoxy-5-methylphenyl)ethenyl]-2-phenyl-1,3-thiazole.
Molecular Properties
| Compound Name | 4-[(E)-2-(3,4-dimethoxy-5-methylphenyl)ethenyl]-2-phenyl-1,3-thiazole |
| PubChem CID | 58477864 |
| Molecular Formula | C20H19NO2S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 4-[(E)-2-(3,4-dimethoxy-5-methylphenyl)ethenyl]-2-phenyl-1,3-thiazole |
| SMILES | COc1cc(/C=C/c2csc(-c3ccccc3)n2)cc(C)c1OC |
| InChI | InChI=1S/C20H19NO2S/c1-14-11-15(12-18(22-2)19(14)23-3)9-10-17-13-24-20(21-17)16-7-5-4-6-8-16/h4-13H,1-3H3/b10-9+ |
| InChIKey | TVMCMPMXGXOWJI-MDZDMXLPSA-N |
| XLogP | 5.31 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(E)-2-(3,4-dimethoxy-5-methylphenyl)ethenyl]-2-phenyl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-2-(3,4-dimethoxy-5-methylphenyl)ethenyl]-2-phenyl-1,3-thiazole?
The IUPAC name of 4-[(E)-2-(3,4-dimethoxy-5-methylphenyl)ethenyl]-2-phenyl-1,3-thiazole (CID 58477864) is 4-[(E)-2-(3,4-dimethoxy-5-methylphenyl)ethenyl]-2-phenyl-1,3-thiazole.
What is the SMILES notation for 4-[(E)-2-(3,4-dimethoxy-5-methylphenyl)ethenyl]-2-phenyl-1,3-thiazole?
The canonical SMILES for 4-[(E)-2-(3,4-dimethoxy-5-methylphenyl)ethenyl]-2-phenyl-1,3-thiazole is COc1cc(/C=C/c2csc(-c3ccccc3)n2)cc(C)c1OC.
What is the InChIKey of 4-[(E)-2-(3,4-dimethoxy-5-methylphenyl)ethenyl]-2-phenyl-1,3-thiazole?
The InChIKey is TVMCMPMXGXOWJI-MDZDMXLPSA-N. The full InChI is InChI=1S/C20H19NO2S/c1-14-11-15(12-18(22-2)19(14)23-3)9-10-17-13-24-20(21-17)16-7-5-4-6-8-16/h4-13H,1-3H3/b10-9+.
What are the key properties of 4-[(E)-2-(3,4-dimethoxy-5-methylphenyl)ethenyl]-2-phenyl-1,3-thiazole?
4-[(E)-2-(3,4-dimethoxy-5-methylphenyl)ethenyl]-2-phenyl-1,3-thiazole has a molecular weight of 337.44 g/mol, XLogP of 5.31, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-2-(3,4-dimethoxy-5-methylphenyl)ethenyl]-2-phenyl-1,3-thiazole is sourced from PubChem (CID 58477864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).