C20H14F3NO5S — CID 58477879
[2,6-dimethoxy-4-(2-phenyl-1,3-thiazole-4-carbonyl)phenyl] 2,2,2-trifluoroacetate (PubChem CID 58477879) has the molecular formula C20H14F3NO5S and a molecular weight of 437.40 g/mol. Its IUPAC name is [2,6-dimethoxy-4-(2-phenyl-1,3-thiazole-4-carbonyl)phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [2,6-dimethoxy-4-(2-phenyl-1,3-thiazole-4-carbonyl)phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 58477879 |
| Molecular Formula | C20H14F3NO5S |
| Molecular Weight | 437.40 g/mol |
| Exact Mass | 437.05 |
| IUPAC Name | [2,6-dimethoxy-4-(2-phenyl-1,3-thiazole-4-carbonyl)phenyl] 2,2,2-trifluoroacetate |
| SMILES | COc1cc(C(=O)c2csc(-c3ccccc3)n2)cc(OC)c1OC(=O)C(F)(F)F |
| InChI | InChI=1S/C20H14F3NO5S/c1-27-14-8-12(9-15(28-2)17(14)29-19(26)20(21,22)23)16(25)13-10-30-18(24-13)11-6-4-3-5-7-11/h3-10H,1-2H3 |
| InChIKey | PHXAIBQTRIRDKQ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.40 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|